C24H29ClN2O2 — CID 35576965
(E)-3-(4-chlorophenyl)-N-[(2S)-2-morpholin-4-yl-2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide (PubChem CID 35576965) has the molecular formula C24H29ClN2O2 and a molecular weight of 412.96 g/mol. Its IUPAC name is (E)-3-(4-chlorophenyl)-N-[(2S)-2-morpholin-4-yl-2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide.
| Compound Name | (E)-3-(4-chlorophenyl)-N-[(2S)-2-morpholin-4-yl-2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 35576965 |
| Molecular Formula | C24H29ClN2O2 |
| Molecular Weight | 412.96 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (E)-3-(4-chlorophenyl)-N-[(2S)-2-morpholin-4-yl-2-(4-propan-2-ylphenyl)ethyl]prop-2-enamide |
| SMILES | CC(C)c1ccc([C@@H](CNC(=O)/C=C/c2ccc(Cl)cc2)N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H29ClN2O2/c1-18(2)20-6-8-21(9-7-20)23(27-13-15-29-16-14-27)17-26-24(28)12-5-19-3-10-22(25)11-4-19/h3-12,18,23H,13-17H2,1-2H3,(H,26,28)/b12-5+/t23-/m1/s1 |
| InChIKey | XHCSZVXDAPNWSG-NCMXAVOXSA-N |
| XLogP | 4.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.96 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|