C23H27FN2O3 — CID 55899935
(E)-3-(3-fluoro-4-methoxyphenyl)-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide (PubChem CID 55899935) has the molecular formula C23H27FN2O3 and a molecular weight of 398.48 g/mol. Its IUPAC name is (E)-3-(3-fluoro-4-methoxyphenyl)-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55899935 |
| Molecular Formula | C23H27FN2O3 |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | (E)-3-(3-fluoro-4-methoxyphenyl)-N-[2-(4-methylphenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCC(c2ccc(C)cc2)N2CCOCC2)cc1F |
| InChI | InChI=1S/C23H27FN2O3/c1-17-3-7-19(8-4-17)21(26-11-13-29-14-12-26)16-25-23(27)10-6-18-5-9-22(28-2)20(24)15-18/h3-10,15,21H,11-14,16H2,1-2H3,(H,25,27)/b10-6+ |
| InChIKey | BZHBFBMNOUOVRN-UXBLZVDNSA-N |
| XLogP | 3.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|