C24H28FN3O5 — CID 55463569
(E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]prop-2-enamide (PubChem CID 55463569) has the molecular formula C24H28FN3O5 and a molecular weight of 457.50 g/mol. Its IUPAC name is (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55463569 |
| Molecular Formula | C24H28FN3O5 |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | (E)-3-[4-(2-amino-2-oxoethoxy)-3-methoxyphenyl]-N-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)NCC(c2ccc(F)cc2)N2CCOCC2)ccc1OCC(N)=O |
| InChI | InChI=1S/C24H28FN3O5/c1-31-22-14-17(2-8-21(22)33-16-23(26)29)3-9-24(30)27-15-20(28-10-12-32-13-11-28)18-4-6-19(25)7-5-18/h2-9,14,20H,10-13,15-16H2,1H3,(H2,26,29)(H,27,30)/b9-3+ |
| InChIKey | OFSRUMFADQYPRK-YCRREMRBSA-N |
| XLogP | 1.90 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|