C23H28FN2O4+ — CID 2311906
(E)-3-(3,4-dimethoxyphenyl)-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide (PubChem CID 2311906) has the molecular formula C23H28FN2O4+ and a molecular weight of 415.49 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 2311906 |
| Molecular Formula | C23H28FN2O4+ |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[(2R)-2-(4-fluorophenyl)-2-morpholin-4-ium-4-ylethyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NC[C@@H](c2ccc(F)cc2)[NH+]2CCOCC2)cc1OC |
| InChI | InChI=1S/C23H27FN2O4/c1-28-21-9-3-17(15-22(21)29-2)4-10-23(27)25-16-20(26-11-13-30-14-12-26)18-5-7-19(24)8-6-18/h3-10,15,20H,11-14,16H2,1-2H3,(H,25,27)/p+1/b10-4+/t20-/m0/s1 |
| InChIKey | OVGJGPGXSFXMNT-KUIFVVTRSA-O |
| XLogP | 1.63 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|