C26H30N2O8 — CID 5470540
methyl 2,3-bis[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoate (PubChem CID 5470540) has the molecular formula C26H30N2O8 and a molecular weight of 498.53 g/mol. Its IUPAC name is methyl 2,3-bis[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl 2,3-bis[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 5470540 |
| Molecular Formula | C26H30N2O8 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | methyl 2,3-bis[[(E)-3-(3,4-dimethoxyphenyl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)C(CNC(=O)/C=C/c1ccc(OC)c(OC)c1)NC(=O)/C=C/c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C26H30N2O8/c1-32-20-10-6-17(14-22(20)34-3)8-12-24(29)27-16-19(26(31)36-5)28-25(30)13-9-18-7-11-21(33-2)23(15-18)35-4/h6-15,19H,16H2,1-5H3,(H,27,29)(H,28,30)/b12-8+,13-9+ |
| InChIKey | NFZFVFAKLQJGNO-QHKWOANTSA-N |
| XLogP | 2.22 |
| TPSA | 121.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|