C13H14F3NO3 — CID 74852248
3-(3,4-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide (PubChem CID 74852248) has the molecular formula C13H14F3NO3 and a molecular weight of 289.25 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
|---|---|
| PubChem CID | 74852248 |
| Molecular Formula | C13H14F3NO3 |
| Molecular Weight | 289.25 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(2,2,2-trifluoroethyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCC(F)(F)F)cc1OC |
| InChI | InChI=1S/C13H14F3NO3/c1-19-10-5-3-9(7-11(10)20-2)4-6-12(18)17-8-13(14,15)16/h3-7H,8H2,1-2H3,(H,17,18) |
| InChIKey | VIPYKSFWQJBWLG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|