C15H19FN2O3 — CID 103597963
3-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]-2,2-dimethylpropanamide (PubChem CID 103597963) has the molecular formula C15H19FN2O3 and a molecular weight of 294.33 g/mol. Its IUPAC name is 3-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]-2,2-dimethylpropanamide.
| Compound Name | 3-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 103597963 |
| Molecular Formula | C15H19FN2O3 |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 3-[3-(3-fluoro-4-methoxyphenyl)prop-2-enoylamino]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(C=CC(=O)NCC(C)(C)C(N)=O)cc1F |
| InChI | InChI=1S/C15H19FN2O3/c1-15(2,14(17)20)9-18-13(19)7-5-10-4-6-12(21-3)11(16)8-10/h4-8H,9H2,1-3H3,(H2,17,20)(H,18,19) |
| InChIKey | HWCXNMYQZHYPEZ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|