C21H26N2O4S — CID 5207843
3-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide (PubChem CID 5207843) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 5207843 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)NCC(c2cccs2)N2CCOCC2)cc1OC |
| InChI | InChI=1S/C21H26N2O4S/c1-25-18-7-5-16(14-19(18)26-2)6-8-21(24)22-15-17(20-4-3-13-28-20)23-9-11-27-12-10-23/h3-8,13-14,17H,9-12,15H2,1-2H3,(H,22,24) |
| InChIKey | LHRFLAWVIVQGGC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|