C17H19BrN2O3S — CID 47005195
(E)-3-(5-bromofuran-2-yl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide (PubChem CID 47005195) has the molecular formula C17H19BrN2O3S and a molecular weight of 411.32 g/mol. Its IUPAC name is (E)-3-(5-bromofuran-2-yl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromofuran-2-yl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 47005195 |
| Molecular Formula | C17H19BrN2O3S |
| Molecular Weight | 411.32 g/mol |
| Exact Mass | 410.03 |
| IUPAC Name | (E)-3-(5-bromofuran-2-yl)-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)o1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H19BrN2O3S/c18-16-5-3-13(23-16)4-6-17(21)19-12-14(15-2-1-11-24-15)20-7-9-22-10-8-20/h1-6,11,14H,7-10,12H2,(H,19,21)/b6-4+ |
| InChIKey | WIMRYHGGQAIFKF-GQCTYLIASA-N |
| XLogP | 3.31 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|