C15H17BrN2O2S — CID 34981283
5-bromo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide (PubChem CID 34981283) has the molecular formula C15H17BrN2O2S and a molecular weight of 369.28 g/mol. Its IUPAC name is 5-bromo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34981283 |
| Molecular Formula | C15H17BrN2O2S |
| Molecular Weight | 369.28 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 5-bromo-N-[(2S)-2-pyrrolidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H17BrN2O2S/c16-14-6-5-12(20-14)15(19)17-10-11(13-4-3-9-21-13)18-7-1-2-8-18/h3-6,9,11H,1-2,7-8,10H2,(H,17,19)/t11-/m0/s1 |
| InChIKey | BLAKJTVVWPWXRO-NSHDSACASA-N |
| XLogP | 3.67 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.28 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |