C19H24N2OS — CID 35042267
N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]benzamide (PubChem CID 35042267) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]benzamide.
| Compound Name | N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 35042267 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]benzamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCCCCC1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2OS/c22-19(16-9-4-3-5-10-16)20-15-17(18-11-8-14-23-18)21-12-6-1-2-7-13-21/h3-5,8-11,14,17H,1-2,6-7,12-13,15H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | PNBJIIGNWVFPEN-KRWDZBQOSA-N |
| XLogP | 4.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |