C19H24Cl2N2OS — CID 52984491
N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-chlorobenzamide;hydrochloride (PubChem CID 52984491) has the molecular formula C19H24Cl2N2OS and a molecular weight of 399.39 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-chlorobenzamide;hydrochloride.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-chlorobenzamide;hydrochloride |
|---|---|
| PubChem CID | 52984491 |
| Molecular Formula | C19H24Cl2N2OS |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-chlorobenzamide;hydrochloride |
| SMILES | Cl.O=C(NCC(c1cccs1)N1CCCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H23ClN2OS.ClH/c20-16-9-7-15(8-10-16)19(23)21-14-17(18-6-5-13-24-18)22-11-3-1-2-4-12-22;/h5-10,13,17H,1-4,11-12,14H2,(H,21,23);1H |
| InChIKey | SXYMZMPCVYQCOX-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |