C20H26Cl2N2OS — CID 52984654
N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-2-(4-chlorophenyl)acetamide;hydrochloride (PubChem CID 52984654) has the molecular formula C20H26Cl2N2OS and a molecular weight of 413.41 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-2-(4-chlorophenyl)acetamide;hydrochloride.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-2-(4-chlorophenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 52984654 |
| Molecular Formula | C20H26Cl2N2OS |
| Molecular Weight | 413.41 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-2-(4-chlorophenyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(Cc1ccc(Cl)cc1)NCC(c1cccs1)N1CCCCCC1 |
| InChI | InChI=1S/C20H25ClN2OS.ClH/c21-17-9-7-16(8-10-17)14-20(24)22-15-18(19-6-5-13-25-19)23-11-3-1-2-4-12-23;/h5-10,13,18H,1-4,11-12,14-15H2,(H,22,24);1H |
| InChIKey | KVHDWIOXEAVMKP-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.41 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |