C19H23ClN2OS — CID 16931253
2-(4-chlorophenyl)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide (PubChem CID 16931253) has the molecular formula C19H23ClN2OS and a molecular weight of 362.93 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide |
|---|---|
| PubChem CID | 16931253 |
| Molecular Formula | C19H23ClN2OS |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NCC(c1ccsc1)N1CCCCC1 |
| InChI | InChI=1S/C19H23ClN2OS/c20-17-6-4-15(5-7-17)12-19(23)21-13-18(16-8-11-24-14-16)22-9-2-1-3-10-22/h4-8,11,14,18H,1-3,9-10,12-13H2,(H,21,23) |
| InChIKey | FJZHZRPSJAGZLC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |