C19H22Cl2N2OS — CID 16931838
N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-2,4-dichlorobenzamide (PubChem CID 16931838) has the molecular formula C19H22Cl2N2OS and a molecular weight of 397.37 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-2,4-dichlorobenzamide.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 16931838 |
| Molecular Formula | C19H22Cl2N2OS |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-3-ylethyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NCC(c1ccsc1)N1CCCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H22Cl2N2OS/c20-15-5-6-16(17(21)11-15)19(24)22-12-18(14-7-10-25-13-14)23-8-3-1-2-4-9-23/h5-7,10-11,13,18H,1-4,8-9,12H2,(H,22,24) |
| InChIKey | IUFQXTZPZPTLRA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |