C18H20Cl2N2O2 — CID 18161350
2,4-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide (PubChem CID 18161350) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 2,4-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 18161350 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2,4-dichloro-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O2/c19-13-6-7-14(15(20)11-13)18(23)21-12-16(17-5-4-10-24-17)22-8-2-1-3-9-22/h4-7,10-11,16H,1-3,8-9,12H2,(H,21,23) |
| InChIKey | GGTBVLIALCUDFC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |