C20H24Cl2N2O2 — CID 46605718
3-(2,4-dichlorophenyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide (PubChem CID 46605718) has the molecular formula C20H24Cl2N2O2 and a molecular weight of 395.33 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide |
|---|---|
| PubChem CID | 46605718 |
| Molecular Formula | C20H24Cl2N2O2 |
| Molecular Weight | 395.33 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]propanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1Cl)NCC(c1ccco1)N1CCCCC1 |
| InChI | InChI=1S/C20H24Cl2N2O2/c21-16-8-6-15(17(22)13-16)7-9-20(25)23-14-18(19-5-4-12-26-19)24-10-2-1-3-11-24/h4-6,8,12-13,18H,1-3,7,9-11,14H2,(H,23,25) |
| InChIKey | IUUAWOFRTFKXJL-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |