C19H22Cl2N2O2 — CID 112503384
N-[2-(azepan-1-yl)-2-(furan-2-yl)ethyl]-2,4-dichlorobenzamide (PubChem CID 112503384) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-(furan-2-yl)ethyl]-2,4-dichlorobenzamide.
| Compound Name | N-[2-(azepan-1-yl)-2-(furan-2-yl)ethyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 112503384 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-(furan-2-yl)ethyl]-2,4-dichlorobenzamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCCCC1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H22Cl2N2O2/c20-14-7-8-15(16(21)12-14)19(24)22-13-17(18-6-5-11-25-18)23-9-3-1-2-4-10-23/h5-8,11-12,17H,1-4,9-10,13H2,(H,22,24) |
| InChIKey | HEQRSRUZLHHULG-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |