C19H22ClN3O3 — CID 7972625
2-chloro-N-[2-[[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]benzamide (PubChem CID 7972625) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 2-chloro-N-[2-[[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-N-[2-[[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 7972625 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-chloro-N-[2-[[(2S)-2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1Cl)NC[C@@H](c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C19H22ClN3O3/c20-15-7-2-1-6-14(15)19(25)22-13-18(24)21-12-16(17-8-5-11-26-17)23-9-3-4-10-23/h1-2,5-8,11,16H,3-4,9-10,12-13H2,(H,21,24)(H,22,25)/t16-/m0/s1 |
| InChIKey | LSEPNICNLHPPQH-INIZCTEOSA-N |
| XLogP | 2.62 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |