C18H22N2O2 — CID 43842816
N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylbenzamide (PubChem CID 43842816) has the molecular formula C18H22N2O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylbenzamide.
| Compound Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 43842816 |
| Molecular Formula | C18H22N2O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C18H22N2O2/c1-14-7-2-3-8-15(14)18(21)19-13-16(17-9-6-12-22-17)20-10-4-5-11-20/h2-3,6-9,12,16H,4-5,10-11,13H2,1H3,(H,19,21) |
| InChIKey | JVINVTSFOFWELF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |