C17H18Cl2N2OS — CID 40847528
3,4-dichloro-N-[(2R)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzamide (PubChem CID 40847528) has the molecular formula C17H18Cl2N2OS and a molecular weight of 369.32 g/mol. Its IUPAC name is 3,4-dichloro-N-[(2R)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzamide.
| Compound Name | 3,4-dichloro-N-[(2R)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzamide |
|---|---|
| PubChem CID | 40847528 |
| Molecular Formula | C17H18Cl2N2OS |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | 3,4-dichloro-N-[(2R)-2-pyrrolidin-1-yl-2-thiophen-3-ylethyl]benzamide |
| SMILES | O=C(NC[C@@H](c1ccsc1)N1CCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H18Cl2N2OS/c18-14-4-3-12(9-15(14)19)17(22)20-10-16(13-5-8-23-11-13)21-6-1-2-7-21/h3-5,8-9,11,16H,1-2,6-7,10H2,(H,20,22)/t16-/m0/s1 |
| InChIKey | URINTBWRYSKEDR-INIZCTEOSA-N |
| XLogP | 4.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |