C17H19N3O3S — CID 16931514
3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)benzamide (PubChem CID 16931514) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)benzamide.
| Compound Name | 3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 16931514 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-nitro-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)benzamide |
| SMILES | O=C(NCC(c1ccsc1)N1CCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H19N3O3S/c21-17(13-4-3-5-15(10-13)20(22)23)18-11-16(14-6-9-24-12-14)19-7-1-2-8-19/h3-6,9-10,12,16H,1-2,7-8,11H2,(H,18,21) |
| InChIKey | IYJOWOAAVRQOBR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|