C14H14N2O4S — CID 121132093
N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-nitrobenzamide (PubChem CID 121132093) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-nitrobenzamide.
| Compound Name | N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 121132093 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | N-(3-hydroxy-3-thiophen-3-ylpropyl)-3-nitrobenzamide |
| SMILES | O=C(NCCC(O)c1ccsc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H14N2O4S/c17-13(11-5-7-21-9-11)4-6-15-14(18)10-2-1-3-12(8-10)16(19)20/h1-3,5,7-9,13,17H,4,6H2,(H,15,18) |
| InChIKey | QWCLQMQSCWADCG-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|