C12H14N2O5 — CID 80538103
2-methyl-4-[(3-nitrobenzoyl)amino]butanoic acid (PubChem CID 80538103) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 2-methyl-4-[(3-nitrobenzoyl)amino]butanoic acid.
| Compound Name | 2-methyl-4-[(3-nitrobenzoyl)amino]butanoic acid |
|---|---|
| PubChem CID | 80538103 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-methyl-4-[(3-nitrobenzoyl)amino]butanoic acid |
| SMILES | CC(CCNC(=O)c1cccc([N+](=O)[O-])c1)C(=O)O |
| InChI | InChI=1S/C12H14N2O5/c1-8(12(16)17)5-6-13-11(15)9-3-2-4-10(7-9)14(18)19/h2-4,7-8H,5-6H2,1H3,(H,13,15)(H,16,17) |
| InChIKey | FWUJPHWCHPQYNJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|