C13H11FN2O4S — CID 106434940
2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)-5-nitrobenzamide (PubChem CID 106434940) has the molecular formula C13H11FN2O4S and a molecular weight of 310.31 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)-5-nitrobenzamide.
| Compound Name | 2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)-5-nitrobenzamide |
|---|---|
| PubChem CID | 106434940 |
| Molecular Formula | C13H11FN2O4S |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)-5-nitrobenzamide |
| SMILES | O=C(NCC(O)c1ccsc1)c1cc([N+](=O)[O-])ccc1F |
| InChI | InChI=1S/C13H11FN2O4S/c14-11-2-1-9(16(19)20)5-10(11)13(18)15-6-12(17)8-3-4-21-7-8/h1-5,7,12,17H,6H2,(H,15,18) |
| InChIKey | BDENEGWJEIUMSV-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|