C12H12N2O4S2 — CID 111441379
N-(2-hydroxy-2-thiophen-3-ylethyl)-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 111441379) has the molecular formula C12H12N2O4S2 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-(2-hydroxy-2-thiophen-3-ylethyl)-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 111441379 |
| Molecular Formula | C12H12N2O4S2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.02 |
| IUPAC Name | N-(2-hydroxy-2-thiophen-3-ylethyl)-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCC(O)c2ccsc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N2O4S2/c1-7-9(14(17)18)4-11(20-7)12(16)13-5-10(15)8-2-3-19-6-8/h2-4,6,10,15H,5H2,1H3,(H,13,16) |
| InChIKey | NYTPCTXTRWVPJA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|