C20H18N2O3S — CID 46443466
N-(2,2-diphenylethyl)-5-methyl-4-nitrothiophene-2-carboxamide (PubChem CID 46443466) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is N-(2,2-diphenylethyl)-5-methyl-4-nitrothiophene-2-carboxamide.
| Compound Name | N-(2,2-diphenylethyl)-5-methyl-4-nitrothiophene-2-carboxamide |
|---|---|
| PubChem CID | 46443466 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-(2,2-diphenylethyl)-5-methyl-4-nitrothiophene-2-carboxamide |
| SMILES | Cc1sc(C(=O)NCC(c2ccccc2)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18N2O3S/c1-14-18(22(24)25)12-19(26-14)20(23)21-13-17(15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-12,17H,13H2,1H3,(H,21,23) |
| InChIKey | IHTMEIOULVWFMR-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|