C19H23N5O4S — CID 16932326
N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-N'-(3-nitrophenyl)oxamide (PubChem CID 16932326) has the molecular formula C19H23N5O4S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-N'-(3-nitrophenyl)oxamide.
| Compound Name | N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-N'-(3-nitrophenyl)oxamide |
|---|---|
| PubChem CID | 16932326 |
| Molecular Formula | C19H23N5O4S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | N-[2-(4-methylpiperazin-1-yl)-2-thiophen-3-ylethyl]-N'-(3-nitrophenyl)oxamide |
| SMILES | CN1CCN(C(CNC(=O)C(=O)Nc2cccc([N+](=O)[O-])c2)c2ccsc2)CC1 |
| InChI | InChI=1S/C19H23N5O4S/c1-22-6-8-23(9-7-22)17(14-5-10-29-13-14)12-20-18(25)19(26)21-15-3-2-4-16(11-15)24(27)28/h2-5,10-11,13,17H,6-9,12H2,1H3,(H,20,25)(H,21,26) |
| InChIKey | OYOOGNIYYFTUJA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 107.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|