C21H26N4O3 — CID 51974312
N'-(3-hydroxyphenyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide (PubChem CID 51974312) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N'-(3-hydroxyphenyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide.
| Compound Name | N'-(3-hydroxyphenyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide |
|---|---|
| PubChem CID | 51974312 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N'-(3-hydroxyphenyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide |
| SMILES | CN1CCN([C@@H](CNC(=O)C(=O)Nc2cccc(O)c2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26N4O3/c1-24-10-12-25(13-11-24)19(16-6-3-2-4-7-16)15-22-20(27)21(28)23-17-8-5-9-18(26)14-17/h2-9,14,19,26H,10-13,15H2,1H3,(H,22,27)(H,23,28)/t19-/m0/s1 |
| InChIKey | UZMNBYAMJFDZMF-IBGZPJMESA-N |
| XLogP | 1.44 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|