C21H27N5O3 — CID 51971264
N'-(6-methoxy-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide (PubChem CID 51971264) has the molecular formula C21H27N5O3 and a molecular weight of 397.48 g/mol. Its IUPAC name is N'-(6-methoxy-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide.
| Compound Name | N'-(6-methoxy-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide |
|---|---|
| PubChem CID | 51971264 |
| Molecular Formula | C21H27N5O3 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | N'-(6-methoxy-3-pyridinyl)-N-[(2R)-2-(4-methylpiperazin-1-yl)-2-phenylethyl]oxamide |
| SMILES | COc1ccc(NC(=O)C(=O)NC[C@@H](c2ccccc2)N2CCN(C)CC2)cn1 |
| InChI | InChI=1S/C21H27N5O3/c1-25-10-12-26(13-11-25)18(16-6-4-3-5-7-16)15-23-20(27)21(28)24-17-8-9-19(29-2)22-14-17/h3-9,14,18H,10-13,15H2,1-2H3,(H,23,27)(H,24,28)/t18-/m0/s1 |
| InChIKey | VCCNKJWDGJETGG-SFHVURJKSA-N |
| XLogP | 1.13 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|