C27H36N6O3 — CID 16802078
N'-(3-acetamidophenyl)-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]oxamide (PubChem CID 16802078) has the molecular formula C27H36N6O3 and a molecular weight of 492.62 g/mol. Its IUPAC name is N'-(3-acetamidophenyl)-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]oxamide.
| Compound Name | N'-(3-acetamidophenyl)-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]oxamide |
|---|---|
| PubChem CID | 16802078 |
| Molecular Formula | C27H36N6O3 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.28 |
| IUPAC Name | N'-(3-acetamidophenyl)-N-[2-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-2-(4-methylpiperazin-1-yl)ethyl]oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)NCC(c2ccc3c(c2)CCCN3C)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C27H36N6O3/c1-19(34)29-22-7-4-8-23(17-22)30-27(36)26(35)28-18-25(33-14-12-31(2)13-15-33)21-9-10-24-20(16-21)6-5-11-32(24)3/h4,7-10,16-17,25H,5-6,11-15,18H2,1-3H3,(H,28,35)(H,29,34)(H,30,36) |
| InChIKey | ZMYQWNBUCFQBDU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|