C23H27FN4O2 — CID 40890634
N'-(3-fluorophenyl)-N-[(2S)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]oxamide (PubChem CID 40890634) has the molecular formula C23H27FN4O2 and a molecular weight of 410.49 g/mol. Its IUPAC name is N'-(3-fluorophenyl)-N-[(2S)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]oxamide.
| Compound Name | N'-(3-fluorophenyl)-N-[(2S)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]oxamide |
|---|---|
| PubChem CID | 40890634 |
| Molecular Formula | C23H27FN4O2 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N'-(3-fluorophenyl)-N-[(2S)-2-(1-methyl-2,3-dihydroindol-5-yl)-2-pyrrolidin-1-ylethyl]oxamide |
| SMILES | CN1CCc2cc([C@@H](CNC(=O)C(=O)Nc3cccc(F)c3)N3CCCC3)ccc21 |
| InChI | InChI=1S/C23H27FN4O2/c1-27-12-9-17-13-16(7-8-20(17)27)21(28-10-2-3-11-28)15-25-22(29)23(30)26-19-6-4-5-18(24)14-19/h4-8,13-14,21H,2-3,9-12,15H2,1H3,(H,25,29)(H,26,30)/t21-/m1/s1 |
| InChIKey | CGTSHYYVZCFWRA-OAQYLSRUSA-N |
| XLogP | 2.71 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|