C19H23N3O3S — CID 16932385
N'-(3-methoxyphenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)oxamide (PubChem CID 16932385) has the molecular formula C19H23N3O3S and a molecular weight of 373.48 g/mol. Its IUPAC name is N'-(3-methoxyphenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)oxamide.
| Compound Name | N'-(3-methoxyphenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)oxamide |
|---|---|
| PubChem CID | 16932385 |
| Molecular Formula | C19H23N3O3S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | N'-(3-methoxyphenyl)-N-(2-pyrrolidin-1-yl-2-thiophen-3-ylethyl)oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)NCC(c2ccsc2)N2CCCC2)c1 |
| InChI | InChI=1S/C19H23N3O3S/c1-25-16-6-4-5-15(11-16)21-19(24)18(23)20-12-17(14-7-10-26-13-14)22-8-2-3-9-22/h4-7,10-11,13,17H,2-3,8-9,12H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | NIEJDKWIGGHORR-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|