C22H30N2O3S — CID 16931298
3,4-diethoxy-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzamide (PubChem CID 16931298) has the molecular formula C22H30N2O3S and a molecular weight of 402.56 g/mol. Its IUPAC name is 3,4-diethoxy-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzamide.
| Compound Name | 3,4-diethoxy-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 16931298 |
| Molecular Formula | C22H30N2O3S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 3,4-diethoxy-N-(2-piperidin-1-yl-2-thiophen-3-ylethyl)benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(c2ccsc2)N2CCCCC2)cc1OCC |
| InChI | InChI=1S/C22H30N2O3S/c1-3-26-20-9-8-17(14-21(20)27-4-2)22(25)23-15-19(18-10-13-28-16-18)24-11-6-5-7-12-24/h8-10,13-14,16,19H,3-7,11-12,15H2,1-2H3,(H,23,25) |
| InChIKey | CTWCRMKUSXNZNL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |