C21H28N2O4 — CID 4807732
3,4-diethoxy-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]benzamide (PubChem CID 4807732) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is 3,4-diethoxy-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]benzamide.
| Compound Name | 3,4-diethoxy-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 4807732 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 3,4-diethoxy-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]benzamide |
| SMILES | CCOc1ccc(C(=O)NCC(c2ccco2)N2CCCC2)cc1OCC |
| InChI | InChI=1S/C21H28N2O4/c1-3-25-19-10-9-16(14-20(19)26-4-2)21(24)22-15-17(18-8-7-13-27-18)23-11-5-6-12-23/h7-10,13-14,17H,3-6,11-12,15H2,1-2H3,(H,22,24) |
| InChIKey | SOVCTXJBCKDCSX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |