C23H24N2OS — CID 42917071
4-phenyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 42917071) has the molecular formula C23H24N2OS and a molecular weight of 376.53 g/mol. Its IUPAC name is 4-phenyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-phenyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 42917071 |
| Molecular Formula | C23H24N2OS |
| Molecular Weight | 376.53 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 4-phenyl-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24N2OS/c26-23(20-12-10-19(11-13-20)18-7-2-1-3-8-18)24-17-21(22-9-6-16-27-22)25-14-4-5-15-25/h1-3,6-13,16,21H,4-5,14-15,17H2,(H,24,26) |
| InChIKey | GHFQYBQTHUKJCE-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |