C18H20F2N2O2S — CID 46522609
4-(difluoromethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide (PubChem CID 46522609) has the molecular formula C18H20F2N2O2S and a molecular weight of 366.43 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide.
| Compound Name | 4-(difluoromethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
|---|---|
| PubChem CID | 46522609 |
| Molecular Formula | C18H20F2N2O2S |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 4-(difluoromethoxy)-N-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)benzamide |
| SMILES | O=C(NCC(c1cccs1)N1CCCC1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H20F2N2O2S/c19-18(20)24-14-7-5-13(6-8-14)17(23)21-12-15(16-4-3-11-25-16)22-9-1-2-10-22/h3-8,11,15,18H,1-2,9-10,12H2,(H,21,23) |
| InChIKey | YWZXSPIXWJENIK-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |