C18H22N2OS — CID 34950040
N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]benzamide (PubChem CID 34950040) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]benzamide.
| Compound Name | N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]benzamide |
|---|---|
| PubChem CID | 34950040 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]benzamide |
| SMILES | O=C(NC[C@H](c1cccs1)N1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2OS/c21-18(15-8-3-1-4-9-15)19-14-16(17-10-7-13-22-17)20-11-5-2-6-12-20/h1,3-4,7-10,13,16H,2,5-6,11-12,14H2,(H,19,21)/t16-/m1/s1 |
| InChIKey | OTTZSKGLDYXAOQ-MRXNPFEDSA-N |
| XLogP | 3.71 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |