C23H33ClN2OS — CID 52984647
N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-tert-butylbenzamide;hydrochloride (PubChem CID 52984647) has the molecular formula C23H33ClN2OS and a molecular weight of 421.05 g/mol. Its IUPAC name is N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-tert-butylbenzamide;hydrochloride.
| Compound Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-tert-butylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 52984647 |
| Molecular Formula | C23H33ClN2OS |
| Molecular Weight | 421.05 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-[2-(azepan-1-yl)-2-thiophen-2-ylethyl]-4-tert-butylbenzamide;hydrochloride |
| SMILES | CC(C)(C)c1ccc(C(=O)NCC(c2cccs2)N2CCCCCC2)cc1.Cl |
| InChI | InChI=1S/C23H32N2OS.ClH/c1-23(2,3)19-12-10-18(11-13-19)22(26)24-17-20(21-9-8-16-27-21)25-14-6-4-5-7-15-25;/h8-13,16,20H,4-7,14-15,17H2,1-3H3,(H,24,26);1H |
| InChIKey | DAAMCZLOMRPQKJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.05 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |