C16H19BrN2O2S — CID 35043440
5-bromo-N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide (PubChem CID 35043440) has the molecular formula C16H19BrN2O2S and a molecular weight of 383.31 g/mol. Its IUPAC name is 5-bromo-N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35043440 |
| Molecular Formula | C16H19BrN2O2S |
| Molecular Weight | 383.31 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 5-bromo-N-[(2R)-2-piperidin-1-yl-2-thiophen-2-ylethyl]furan-2-carboxamide |
| SMILES | O=C(NC[C@H](c1cccs1)N1CCCCC1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H19BrN2O2S/c17-15-7-6-13(21-15)16(20)18-11-12(14-5-4-10-22-14)19-8-2-1-3-9-19/h4-7,10,12H,1-3,8-9,11H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | ALKDTCCYRWXJTJ-GFCCVEGCSA-N |
| XLogP | 4.06 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.31 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |