C22H23BrN2O3S — CID 35575728
N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]-7-bromo-4-oxochromene-2-carboxamide (PubChem CID 35575728) has the molecular formula C22H23BrN2O3S and a molecular weight of 475.41 g/mol. Its IUPAC name is N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]-7-bromo-4-oxochromene-2-carboxamide.
| Compound Name | N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]-7-bromo-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35575728 |
| Molecular Formula | C22H23BrN2O3S |
| Molecular Weight | 475.41 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | N-[(2S)-2-(azepan-1-yl)-2-thiophen-2-ylethyl]-7-bromo-4-oxochromene-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCCCCC1)c1cc(=O)c2ccc(Br)cc2o1 |
| InChI | InChI=1S/C22H23BrN2O3S/c23-15-7-8-16-18(26)13-20(28-19(16)12-15)22(27)24-14-17(21-6-5-11-29-21)25-9-3-1-2-4-10-25/h5-8,11-13,17H,1-4,9-10,14H2,(H,24,27)/t17-/m0/s1 |
| InChIKey | XUAAXHPVIUIHCF-KRWDZBQOSA-N |
| XLogP | 4.96 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |