C20H19BrN2O4S — CID 35576051
7-bromo-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxochromene-2-carboxamide (PubChem CID 35576051) has the molecular formula C20H19BrN2O4S and a molecular weight of 463.35 g/mol. Its IUPAC name is 7-bromo-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxochromene-2-carboxamide.
| Compound Name | 7-bromo-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 35576051 |
| Molecular Formula | C20H19BrN2O4S |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 7-bromo-N-[(2S)-2-morpholin-4-yl-2-thiophen-2-ylethyl]-4-oxochromene-2-carboxamide |
| SMILES | O=C(NC[C@@H](c1cccs1)N1CCOCC1)c1cc(=O)c2ccc(Br)cc2o1 |
| InChI | InChI=1S/C20H19BrN2O4S/c21-13-3-4-14-16(24)11-18(27-17(14)10-13)20(25)22-12-15(19-2-1-9-28-19)23-5-7-26-8-6-23/h1-4,9-11,15H,5-8,12H2,(H,22,25)/t15-/m0/s1 |
| InChIKey | HZGKOXWVOGYADK-HNNXBMFYSA-N |
| XLogP | 3.42 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |