C20H20ClF3N2O2S — CID 37101741
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]prop-2-enamide (PubChem CID 37101741) has the molecular formula C20H20ClF3N2O2S and a molecular weight of 444.91 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 37101741 |
| Molecular Formula | C20H20ClF3N2O2S |
| Molecular Weight | 444.91 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2R)-2-morpholin-4-yl-2-thiophen-2-ylethyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)NC[C@H](c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C20H20ClF3N2O2S/c21-16-5-3-14(12-15(16)20(22,23)24)4-6-19(27)25-13-17(18-2-1-11-29-18)26-7-9-28-10-8-26/h1-6,11-12,17H,7-10,13H2,(H,25,27)/b6-4+/t17-/m1/s1 |
| InChIKey | ANQYZIWKGLBVNK-UKINESCASA-N |
| XLogP | 4.62 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|