C20H19ClF3N3O2 — CID 33029863
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]prop-2-enamide (PubChem CID 33029863) has the molecular formula C20H19ClF3N3O2 and a molecular weight of 425.84 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 33029863 |
| Molecular Formula | C20H19ClF3N3O2 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-[(2-morpholin-4-yl-4-pyridinyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)NCc1ccnc(N2CCOCC2)c1 |
| InChI | InChI=1S/C20H19ClF3N3O2/c21-17-3-1-14(11-16(17)20(22,23)24)2-4-19(28)26-13-15-5-6-25-18(12-15)27-7-9-29-10-8-27/h1-6,11-12H,7-10,13H2,(H,26,28)/b4-2+ |
| InChIKey | MYXJMZIQWPBRJY-DUXPYHPUSA-N |
| XLogP | 3.92 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|