C19H19ClFN3O2 — CID 24613271
(E)-3-(3-chloro-4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]prop-2-enamide (PubChem CID 24613271) has the molecular formula C19H19ClFN3O2 and a molecular weight of 375.83 g/mol. Its IUPAC name is (E)-3-(3-chloro-4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 24613271 |
| Molecular Formula | C19H19ClFN3O2 |
| Molecular Weight | 375.83 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | (E)-3-(3-chloro-4-fluorophenyl)-N-[(6-morpholin-4-yl-3-pyridinyl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)c(Cl)c1)NCc1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C19H19ClFN3O2/c20-16-11-14(1-4-17(16)21)3-6-19(25)23-13-15-2-5-18(22-12-15)24-7-9-26-10-8-24/h1-6,11-12H,7-10,13H2,(H,23,25)/b6-3+ |
| InChIKey | DOGREMDFOLUXGV-ZZXKWVIFSA-N |
| XLogP | 3.04 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.83 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|