C17H12ClF4NO — CID 123282464
N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 123282464) has the molecular formula C17H12ClF4NO and a molecular weight of 357.73 g/mol. Its IUPAC name is N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 123282464 |
| Molecular Formula | C17H12ClF4NO |
| Molecular Weight | 357.73 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | N-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(F)cc1)NCc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H12ClF4NO/c18-15-7-3-12(9-14(15)17(20,21)22)10-23-16(24)8-4-11-1-5-13(19)6-2-11/h1-9H,10H2,(H,23,24) |
| InChIKey | VOMLTQPUXKABBD-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|