C11H9ClF3NO — CID 47099874
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methylprop-2-enamide (PubChem CID 47099874) has the molecular formula C11H9ClF3NO and a molecular weight of 263.65 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 47099874 |
| Molecular Formula | C11H9ClF3NO |
| Molecular Weight | 263.65 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-methylprop-2-enamide |
| SMILES | CNC(=O)/C=C/c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H9ClF3NO/c1-16-10(17)5-3-7-2-4-9(12)8(6-7)11(13,14)15/h2-6H,1H3,(H,16,17)/b5-3+ |
| InChIKey | JUXYYEUBONQYQZ-HWKANZROSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.65 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|