C16H10ClF4NO — CID 18863151
(E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-fluorophenyl)prop-2-enamide (PubChem CID 18863151) has the molecular formula C16H10ClF4NO and a molecular weight of 343.71 g/mol. Its IUPAC name is (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 18863151 |
| Molecular Formula | C16H10ClF4NO |
| Molecular Weight | 343.71 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | (E)-3-[4-chloro-3-(trifluoromethyl)phenyl]-N-(2-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(C(F)(F)F)c1)Nc1ccccc1F |
| InChI | InChI=1S/C16H10ClF4NO/c17-12-7-5-10(9-11(12)16(19,20)21)6-8-15(23)22-14-4-2-1-3-13(14)18/h1-9H,(H,22,23)/b8-6+ |
| InChIKey | QSLWYBYMVRJUCM-SOFGYWHQSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|