C16H11ClF3NO — CID 715676
N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide (PubChem CID 715676) has the molecular formula C16H11ClF3NO and a molecular weight of 325.72 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 715676 |
| Molecular Formula | C16H11ClF3NO |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H11ClF3NO/c17-14-8-7-12(10-13(14)16(18,19)20)21-15(22)9-6-11-4-2-1-3-5-11/h1-10H,(H,21,22) |
| InChIKey | YGEIDAUDBFUCML-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|