C20H19ClF3NO2 — CID 4992698
3-(2-butoxyphenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 4992698) has the molecular formula C20H19ClF3NO2 and a molecular weight of 397.82 g/mol. Its IUPAC name is 3-(2-butoxyphenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 3-(2-butoxyphenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 4992698 |
| Molecular Formula | C20H19ClF3NO2 |
| Molecular Weight | 397.82 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 3-(2-butoxyphenyl)-N-[4-chloro-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CCCCOc1ccccc1C=CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H19ClF3NO2/c1-2-3-12-27-18-7-5-4-6-14(18)8-11-19(26)25-15-9-10-17(21)16(13-15)20(22,23)24/h4-11,13H,2-3,12H2,1H3,(H,25,26) |
| InChIKey | FRSKPFZOQQQZRH-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.82 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|